C17H19ClN2O3S — CID 17225634
3-[(4-chlorophenyl)sulfonylamino]-N-(2,6-dimethylphenyl)propanamide (PubChem CID 17225634) has the molecular formula C17H19ClN2O3S and a molecular weight of 366.87 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)sulfonylamino]-N-(2,6-dimethylphenyl)propanamide.
| Compound Name | 3-[(4-chlorophenyl)sulfonylamino]-N-(2,6-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 17225634 |
| Molecular Formula | C17H19ClN2O3S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 3-[(4-chlorophenyl)sulfonylamino]-N-(2,6-dimethylphenyl)propanamide |
| SMILES | Cc1cccc(C)c1NC(=O)CCNS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19ClN2O3S/c1-12-4-3-5-13(2)17(12)20-16(21)10-11-19-24(22,23)15-8-6-14(18)7-9-15/h3-9,19H,10-11H2,1-2H3,(H,20,21) |
| InChIKey | ZPGJDHRYQDVUKW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |