C18H19N3O4 — CID 17226172
2-[3-[(3-methoxybenzoyl)amino]propanoylamino]benzamide (PubChem CID 17226172) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 2-[3-[(3-methoxybenzoyl)amino]propanoylamino]benzamide.
| Compound Name | 2-[3-[(3-methoxybenzoyl)amino]propanoylamino]benzamide |
|---|---|
| PubChem CID | 17226172 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-[3-[(3-methoxybenzoyl)amino]propanoylamino]benzamide |
| SMILES | COc1cccc(C(=O)NCCC(=O)Nc2ccccc2C(N)=O)c1 |
| InChI | InChI=1S/C18H19N3O4/c1-25-13-6-4-5-12(11-13)18(24)20-10-9-16(22)21-15-8-3-2-7-14(15)17(19)23/h2-8,11H,9-10H2,1H3,(H2,19,23)(H,20,24)(H,21,22) |
| InChIKey | OVKRZNSFHBRWRG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |