C10H6N6 — CID 17228800
2,3,5,7,13,14-hexazatetracyclo[7.7.0.02,6.010,14]hexadeca-1(9),3,5,7,10,12,15-heptaene (PubChem CID 17228800) has the molecular formula C10H6N6 and a molecular weight of 210.20 g/mol. Its IUPAC name is 2,3,5,7,13,14-hexazatetracyclo[7.7.0.02,6.010,14]hexadeca-1(9),3,5,7,10,12,15-heptaene.
| Compound Name | 2,3,5,7,13,14-hexazatetracyclo[7.7.0.02,6.010,14]hexadeca-1(9),3,5,7,10,12,15-heptaene |
|---|---|
| PubChem CID | 17228800 |
| Molecular Formula | C10H6N6 |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 2,3,5,7,13,14-hexazatetracyclo[7.7.0.02,6.010,14]hexadeca-1(9),3,5,7,10,12,15-heptaene |
| SMILES | c1cc2c3cnc4ncnn4c3ccn2n1 |
| InChI | InChI=1S/C10H6N6/c1-3-13-15-4-2-9-7(8(1)15)5-11-10-12-6-14-16(9)10/h1-6H |
| InChIKey | LTXCMOOZECDDLY-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 60.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |