C23H21BrN2O3 — CID 17229681
5-bromo-N-[4-[ethyl(phenyl)carbamoyl]phenyl]-2-methoxybenzamide (PubChem CID 17229681) has the molecular formula C23H21BrN2O3 and a molecular weight of 453.34 g/mol. Its IUPAC name is 5-bromo-N-[4-[ethyl(phenyl)carbamoyl]phenyl]-2-methoxybenzamide.
| Compound Name | 5-bromo-N-[4-[ethyl(phenyl)carbamoyl]phenyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 17229681 |
| Molecular Formula | C23H21BrN2O3 |
| Molecular Weight | 453.34 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 5-bromo-N-[4-[ethyl(phenyl)carbamoyl]phenyl]-2-methoxybenzamide |
| SMILES | CCN(C(=O)c1ccc(NC(=O)c2cc(Br)ccc2OC)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H21BrN2O3/c1-3-26(19-7-5-4-6-8-19)23(28)16-9-12-18(13-10-16)25-22(27)20-15-17(24)11-14-21(20)29-2/h4-15H,3H2,1-2H3,(H,25,27) |
| InChIKey | YMCZLRHHGBWRGY-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.34 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |