C22H27BrN4O3S — CID 17230007
3-bromo-N-[[4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamothioyl]-4-methoxybenzamide (PubChem CID 17230007) has the molecular formula C22H27BrN4O3S and a molecular weight of 507.45 g/mol. Its IUPAC name is 3-bromo-N-[[4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamothioyl]-4-methoxybenzamide.
| Compound Name | 3-bromo-N-[[4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamothioyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 17230007 |
| Molecular Formula | C22H27BrN4O3S |
| Molecular Weight | 507.45 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | 3-bromo-N-[[4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamothioyl]-4-methoxybenzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(NC(=S)NC(=O)c2ccc(OC)c(Br)c2)cc1 |
| InChI | InChI=1S/C22H27BrN4O3S/c1-4-27(5-2)13-12-24-20(28)15-6-9-17(10-7-15)25-22(31)26-21(29)16-8-11-19(30-3)18(23)14-16/h6-11,14H,4-5,12-13H2,1-3H3,(H,24,28)(H2,25,26,29,31) |
| InChIKey | UVXMDGYJDJUISZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|