C23H21BrN2O3 — CID 17230760
3-[[2-(2-bromo-4-phenylphenoxy)acetyl]amino]-N-ethylbenzamide (PubChem CID 17230760) has the molecular formula C23H21BrN2O3 and a molecular weight of 453.34 g/mol. Its IUPAC name is 3-[[2-(2-bromo-4-phenylphenoxy)acetyl]amino]-N-ethylbenzamide.
| Compound Name | 3-[[2-(2-bromo-4-phenylphenoxy)acetyl]amino]-N-ethylbenzamide |
|---|---|
| PubChem CID | 17230760 |
| Molecular Formula | C23H21BrN2O3 |
| Molecular Weight | 453.34 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 3-[[2-(2-bromo-4-phenylphenoxy)acetyl]amino]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1cccc(NC(=O)COc2ccc(-c3ccccc3)cc2Br)c1 |
| InChI | InChI=1S/C23H21BrN2O3/c1-2-25-23(28)18-9-6-10-19(13-18)26-22(27)15-29-21-12-11-17(14-20(21)24)16-7-4-3-5-8-16/h3-14H,2,15H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | VMANYUFWSADYKV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.34 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |