About 4-octoxybenzoic acid
4-octoxybenzoic acid (PubChem CID 17231) has the molecular formula C15H22O3
and a molecular weight of 250.34 g/mol. Its IUPAC name is 4-octoxybenzoic acid.
Molecular Properties
| Compound Name | 4-octoxybenzoic acid |
| PubChem CID | 17231 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 4-octoxybenzoic acid |
| SMILES | CCCCCCCCOc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C15H22O3/c1-2-3-4-5-6-7-12-18-14-10-8-13(9-11-14)15(16)17/h8-11H,2-7,12H2,1H3,(H,16,17) |
| InChIKey | IALWCYFULVHLEC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-octoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-octoxybenzoic acid?
The IUPAC name of 4-octoxybenzoic acid (CID 17231) is 4-octoxybenzoic acid.
What is the SMILES notation for 4-octoxybenzoic acid?
The canonical SMILES for 4-octoxybenzoic acid is CCCCCCCCOc1ccc(C(=O)O)cc1.
What is the InChIKey of 4-octoxybenzoic acid?
The InChIKey is IALWCYFULVHLEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O3/c1-2-3-4-5-6-7-12-18-14-10-8-13(9-11-14)15(16)17/h8-11H,2-7,12H2,1H3,(H,16,17).
What are the key properties of 4-octoxybenzoic acid?
4-octoxybenzoic acid has a molecular weight of 250.34 g/mol, XLogP of 4.12, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-octoxybenzoic acid is sourced from PubChem (CID 17231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).