C18H23ClN2O3S — CID 17231108
ethyl 1-[3-(2-chlorophenyl)propanoylcarbamothioyl]piperidine-4-carboxylate (PubChem CID 17231108) has the molecular formula C18H23ClN2O3S and a molecular weight of 382.91 g/mol. Its IUPAC name is ethyl 1-[3-(2-chlorophenyl)propanoylcarbamothioyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-(2-chlorophenyl)propanoylcarbamothioyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 17231108 |
| Molecular Formula | C18H23ClN2O3S |
| Molecular Weight | 382.91 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | ethyl 1-[3-(2-chlorophenyl)propanoylcarbamothioyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=S)NC(=O)CCc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C18H23ClN2O3S/c1-2-24-17(23)14-9-11-21(12-10-14)18(25)20-16(22)8-7-13-5-3-4-6-15(13)19/h3-6,14H,2,7-12H2,1H3,(H,20,22,25) |
| InChIKey | NCDCSVQMIMWXMJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.91 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|