C16H24ClNOS — CID 17233906
1'-methylspiro[5a,6,7,8,9,9a-hexahydrothieno[3,2-c]chromene-4,4'-piperidine];hydrochloride (PubChem CID 17233906) has the molecular formula C16H24ClNOS and a molecular weight of 313.89 g/mol. Its IUPAC name is 1'-methylspiro[5a,6,7,8,9,9a-hexahydrothieno[3,2-c]chromene-4,4'-piperidine];hydrochloride.
| Compound Name | 1'-methylspiro[5a,6,7,8,9,9a-hexahydrothieno[3,2-c]chromene-4,4'-piperidine];hydrochloride |
|---|---|
| PubChem CID | 17233906 |
| Molecular Formula | C16H24ClNOS |
| Molecular Weight | 313.89 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 1'-methylspiro[5a,6,7,8,9,9a-hexahydrothieno[3,2-c]chromene-4,4'-piperidine];hydrochloride |
| SMILES | CN1CCC2(CC1)OC1CCCCC1c1sccc12.Cl |
| InChI | InChI=1S/C16H23NOS.ClH/c1-17-9-7-16(8-10-17)13-6-11-19-15(13)12-4-2-3-5-14(12)18-16;/h6,11-12,14H,2-5,7-10H2,1H3;1H |
| InChIKey | FKYYYXULYVOXMJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.89 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |