C16H23NOS — CID 17233907
1'-methylspiro[5a,6,7,8,9,9a-hexahydrothieno[3,2-c]chromene-4,4'-piperidine] (PubChem CID 17233907) has the molecular formula C16H23NOS and a molecular weight of 277.43 g/mol. Its IUPAC name is 1'-methylspiro[5a,6,7,8,9,9a-hexahydrothieno[3,2-c]chromene-4,4'-piperidine].
| Compound Name | 1'-methylspiro[5a,6,7,8,9,9a-hexahydrothieno[3,2-c]chromene-4,4'-piperidine] |
|---|---|
| PubChem CID | 17233907 |
| Molecular Formula | C16H23NOS |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 1'-methylspiro[5a,6,7,8,9,9a-hexahydrothieno[3,2-c]chromene-4,4'-piperidine] |
| SMILES | CN1CCC2(CC1)OC1CCCCC1c1sccc12 |
| InChI | InChI=1S/C16H23NOS/c1-17-9-7-16(8-10-17)13-6-11-19-15(13)12-4-2-3-5-14(12)18-16/h6,11-12,14H,2-5,7-10H2,1H3 |
| InChIKey | JVVJQXXUHSTANP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |