C9H9N3O3 — CID 17233930
4-(2-methoxyphenyl)-1,2,4-triazolidine-3,5-dione (PubChem CID 17233930) has the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-(2-methoxyphenyl)-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 17233930 |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 4-(2-methoxyphenyl)-1,2,4-triazolidine-3,5-dione |
| SMILES | COc1ccccc1-n1c(=O)[nH][nH]c1=O |
| InChI | InChI=1S/C9H9N3O3/c1-15-7-5-3-2-4-6(7)12-8(13)10-11-9(12)14/h2-5H,1H3,(H,10,13)(H,11,14) |
| InChIKey | KNMJXDFGVBCDGF-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 79.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |