About 3-amino-3,4-dihydro-1H-quinolin-2-one;hydroiodide
3-amino-3,4-dihydro-1H-quinolin-2-one;hydroiodide (PubChem CID 17234022) has the molecular formula C9H11IN2O
and a molecular weight of 290.10 g/mol. Its IUPAC name is 3-amino-3,4-dihydro-1H-quinolin-2-one;hydroiodide.
Molecular Properties
| Compound Name | 3-amino-3,4-dihydro-1H-quinolin-2-one;hydroiodide |
| PubChem CID | 17234022 |
| Molecular Formula | C9H11IN2O |
| Molecular Weight | 290.10 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | 3-amino-3,4-dihydro-1H-quinolin-2-one;hydroiodide |
| SMILES | I.NC1Cc2ccccc2NC1=O |
| InChI | InChI=1S/C9H10N2O.HI/c10-7-5-6-3-1-2-4-8(6)11-9(7)12;/h1-4,7H,5,10H2,(H,11,12);1H |
| InChIKey | RFYXFDXHRUPCCY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.10 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-3,4-dihydro-1H-quinolin-2-one;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-3,4-dihydro-1H-quinolin-2-one;hydroiodide?
The IUPAC name of 3-amino-3,4-dihydro-1H-quinolin-2-one;hydroiodide (CID 17234022) is 3-amino-3,4-dihydro-1H-quinolin-2-one;hydroiodide.
What is the SMILES notation for 3-amino-3,4-dihydro-1H-quinolin-2-one;hydroiodide?
The canonical SMILES for 3-amino-3,4-dihydro-1H-quinolin-2-one;hydroiodide is I.NC1Cc2ccccc2NC1=O.
What is the InChIKey of 3-amino-3,4-dihydro-1H-quinolin-2-one;hydroiodide?
The InChIKey is RFYXFDXHRUPCCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O.HI/c10-7-5-6-3-1-2-4-8(6)11-9(7)12;/h1-4,7H,5,10H2,(H,11,12);1H.
What are the key properties of 3-amino-3,4-dihydro-1H-quinolin-2-one;hydroiodide?
3-amino-3,4-dihydro-1H-quinolin-2-one;hydroiodide has a molecular weight of 290.10 g/mol, XLogP of 1.13, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3,4-dihydro-1H-quinolin-2-one;hydroiodide is sourced from PubChem (CID 17234022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).