C20H24N2O3 — CID 17234371
N-ethyl-4-[2-(4-ethylphenoxy)propanoylamino]benzamide (PubChem CID 17234371) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is N-ethyl-4-[2-(4-ethylphenoxy)propanoylamino]benzamide.
| Compound Name | N-ethyl-4-[2-(4-ethylphenoxy)propanoylamino]benzamide |
|---|---|
| PubChem CID | 17234371 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | N-ethyl-4-[2-(4-ethylphenoxy)propanoylamino]benzamide |
| SMILES | CCNC(=O)c1ccc(NC(=O)C(C)Oc2ccc(CC)cc2)cc1 |
| InChI | InChI=1S/C20H24N2O3/c1-4-15-6-12-18(13-7-15)25-14(3)19(23)22-17-10-8-16(9-11-17)20(24)21-5-2/h6-14H,4-5H2,1-3H3,(H,21,24)(H,22,23) |
| InChIKey | VQRDVRPQEULKPW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |