About Ethane;[1-[[1-(methoxymethyl)cyclopropyl]methyl]azetidin-3-yl]methanol
Ethane;[1-[[1-(methoxymethyl)cyclopropyl]methyl]azetidin-3-yl]methanol (PubChem CID 172348365) has the molecular formula C12H25NO2
and a molecular weight of 215.33 g/mol. Its IUPAC name is ethane;[1-[[1-(methoxymethyl)cyclopropyl]methyl]azetidin-3-yl]methanol.
Molecular Properties
| Compound Name | Ethane;[1-[[1-(methoxymethyl)cyclopropyl]methyl]azetidin-3-yl]methanol |
| PubChem CID | 172348365 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.33 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | ethane;[1-[[1-(methoxymethyl)cyclopropyl]methyl]azetidin-3-yl]methanol |
| SMILES | CC.COCC1(CC1)CN2CC(C2)CO |
| InChI | InChI=1S/C10H19NO2.C2H6/c1-13-8-10(2-3-10)7-11-4-9(5-11)6-12;1-2/h9,12H,2-8H2,1H3;1-2H3 |
| InChIKey | HCQCWQXJFCIXAY-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | 174 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Ethane;[1-[[1-(methoxymethyl)cyclopropyl]methyl]azetidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ethane;[1-[[1-(methoxymethyl)cyclopropyl]methyl]azetidin-3-yl]methanol?
The IUPAC name of Ethane;[1-[[1-(methoxymethyl)cyclopropyl]methyl]azetidin-3-yl]methanol (CID 172348365) is ethane;[1-[[1-(methoxymethyl)cyclopropyl]methyl]azetidin-3-yl]methanol.
What is the SMILES notation for Ethane;[1-[[1-(methoxymethyl)cyclopropyl]methyl]azetidin-3-yl]methanol?
The canonical SMILES for Ethane;[1-[[1-(methoxymethyl)cyclopropyl]methyl]azetidin-3-yl]methanol is CC.COCC1(CC1)CN2CC(C2)CO.
What is the InChIKey of Ethane;[1-[[1-(methoxymethyl)cyclopropyl]methyl]azetidin-3-yl]methanol?
The InChIKey is HCQCWQXJFCIXAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2.C2H6/c1-13-8-10(2-3-10)7-11-4-9(5-11)6-12;1-2/h9,12H,2-8H2,1H3;1-2H3.
What are the key properties of Ethane;[1-[[1-(methoxymethyl)cyclopropyl]methyl]azetidin-3-yl]methanol?
Ethane;[1-[[1-(methoxymethyl)cyclopropyl]methyl]azetidin-3-yl]methanol has a molecular weight of 215.33 g/mol, XLogP of not available, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Ethane;[1-[[1-(methoxymethyl)cyclopropyl]methyl]azetidin-3-yl]methanol is sourced from PubChem (CID 172348365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).