C27H28N2O3 — CID 17234965
4-tert-butyl-N-[4-[[(E)-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]benzamide (PubChem CID 17234965) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-[[(E)-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-[[(E)-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 17234965 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 4-tert-butyl-N-[4-[[(E)-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]benzamide |
| SMILES | COc1ccccc1/C=C/C(=O)Nc1ccc(NC(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H28N2O3/c1-27(2,3)21-12-9-20(10-13-21)26(31)29-23-16-14-22(15-17-23)28-25(30)18-11-19-7-5-6-8-24(19)32-4/h5-18H,1-4H3,(H,28,30)(H,29,31)/b18-11+ |
| InChIKey | UMZGZNXJNBXGJA-WOJGMQOQSA-N |
| XLogP | 5.90 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|