C30H36N2O3 — CID 17235107
N-[4-[2-(2-butan-2-ylphenoxy)propanoylamino]phenyl]-4-tert-butylbenzamide (PubChem CID 17235107) has the molecular formula C30H36N2O3 and a molecular weight of 472.63 g/mol. Its IUPAC name is N-[4-[2-(2-butan-2-ylphenoxy)propanoylamino]phenyl]-4-tert-butylbenzamide.
| Compound Name | N-[4-[2-(2-butan-2-ylphenoxy)propanoylamino]phenyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 17235107 |
| Molecular Formula | C30H36N2O3 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | N-[4-[2-(2-butan-2-ylphenoxy)propanoylamino]phenyl]-4-tert-butylbenzamide |
| SMILES | CCC(C)c1ccccc1OC(C)C(=O)Nc1ccc(NC(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H36N2O3/c1-7-20(2)26-10-8-9-11-27(26)35-21(3)28(33)31-24-16-18-25(19-17-24)32-29(34)22-12-14-23(15-13-22)30(4,5)6/h8-21H,7H2,1-6H3,(H,31,33)(H,32,34) |
| InChIKey | ZCUHCAWWYDIRCW-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |