C29H36N2O4 — CID 17236942
N-cyclohexyl-N-methyl-4-(3,4,5-trimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide (PubChem CID 17236942) has the molecular formula C29H36N2O4 and a molecular weight of 476.62 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-4-(3,4,5-trimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide.
| Compound Name | N-cyclohexyl-N-methyl-4-(3,4,5-trimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 17236942 |
| Molecular Formula | C29H36N2O4 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | N-cyclohexyl-N-methyl-4-(3,4,5-trimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
| SMILES | COc1cc(C2Nc3c(C(=O)N(C)C4CCCCC4)cccc3C3C=CCC32)cc(OC)c1OC |
| InChI | InChI=1S/C29H36N2O4/c1-31(19-10-6-5-7-11-19)29(32)23-15-9-14-22-20-12-8-13-21(20)26(30-27(22)23)18-16-24(33-2)28(35-4)25(17-18)34-3/h8-9,12,14-17,19-21,26,30H,5-7,10-11,13H2,1-4H3 |
| InChIKey | YHCGJKFIOXTSGN-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|