C22H23Cl2NO2 — CID 17241343
4-(2,3-dichlorophenyl)-8-(2-ethoxyethoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 17241343) has the molecular formula C22H23Cl2NO2 and a molecular weight of 404.34 g/mol. Its IUPAC name is 4-(2,3-dichlorophenyl)-8-(2-ethoxyethoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 4-(2,3-dichlorophenyl)-8-(2-ethoxyethoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 17241343 |
| Molecular Formula | C22H23Cl2NO2 |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 4-(2,3-dichlorophenyl)-8-(2-ethoxyethoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | CCOCCOc1ccc2c(c1)C1C=CCC1C(c1cccc(Cl)c1Cl)N2 |
| InChI | InChI=1S/C22H23Cl2NO2/c1-2-26-11-12-27-14-9-10-20-18(13-14)15-5-3-6-16(15)22(25-20)17-7-4-8-19(23)21(17)24/h3-5,7-10,13,15-16,22,25H,2,6,11-12H2,1H3 |
| InChIKey | XMVQNDKFYYASCP-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|