C22H25NO2 — CID 17244036
4-(3-methoxyphenyl)-6-propan-2-yloxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 17244036) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-6-propan-2-yloxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 4-(3-methoxyphenyl)-6-propan-2-yloxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 17244036 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 4-(3-methoxyphenyl)-6-propan-2-yloxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | COc1cccc(C2Nc3c(OC(C)C)cccc3C3C=CCC32)c1 |
| InChI | InChI=1S/C22H25NO2/c1-14(2)25-20-12-6-11-19-17-9-5-10-18(17)21(23-22(19)20)15-7-4-8-16(13-15)24-3/h4-9,11-14,17-18,21,23H,10H2,1-3H3 |
| InChIKey | QUUFJELSEKBDDU-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|