C15H16INO2S — CID 172442625
N-[(4-hydroxyphenyl)methyl]-4-(5-iodothiophen-2-yl)butanamide (PubChem CID 172442625) has the molecular formula C15H16INO2S and a molecular weight of 401.30 g/mol. Its IUPAC name is N-[(4-hydroxyphenyl)methyl]-4-(5-iodothiophen-2-yl)butanamide.
| Compound Name | N-[(4-hydroxyphenyl)methyl]-4-(5-iodothiophen-2-yl)butanamide |
|---|---|
| PubChem CID | 172442625 |
| Molecular Formula | C15H16INO2S |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 400.99 |
| IUPAC Name | N-[(4-hydroxyphenyl)methyl]-4-(5-iodothiophen-2-yl)butanamide |
| SMILES | C1=CC(=CC=C1CNC(=O)CCCC2=CC=C(S2)I)O |
| InChI | InChI=1S/C15H16INO2S/c16-14-9-8-13(20-14)2-1-3-15(19)17-10-11-4-6-12(18)7-5-11/h4-9,18H,1-3,10H2,(H,17,19) |
| InChIKey | MAGLOUFRSHWDNP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 77.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | 308 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|