C8H8N4O3 — CID 17244518
2-[2-ethoxy-1-(1,3,4-oxadiazol-2-yl)ethenyl]-1,3,4-oxadiazole (PubChem CID 17244518) has the molecular formula C8H8N4O3 and a molecular weight of 208.18 g/mol. Its IUPAC name is 2-[2-ethoxy-1-(1,3,4-oxadiazol-2-yl)ethenyl]-1,3,4-oxadiazole.
| Compound Name | 2-[2-ethoxy-1-(1,3,4-oxadiazol-2-yl)ethenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 17244518 |
| Molecular Formula | C8H8N4O3 |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 2-[2-ethoxy-1-(1,3,4-oxadiazol-2-yl)ethenyl]-1,3,4-oxadiazole |
| SMILES | CCOC=C(c1nnco1)c1nnco1 |
| InChI | InChI=1S/C8H8N4O3/c1-2-13-3-6(7-11-9-4-14-7)8-12-10-5-15-8/h3-5H,2H2,1H3 |
| InChIKey | ZNXRDTCEDBORBD-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 87.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|