C16H10Cl2IN3O2S — CID 17245159
2-[[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(3-iodophenyl)acetamide (PubChem CID 17245159) has the molecular formula C16H10Cl2IN3O2S and a molecular weight of 506.15 g/mol. Its IUPAC name is 2-[[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(3-iodophenyl)acetamide.
| Compound Name | 2-[[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(3-iodophenyl)acetamide |
|---|---|
| PubChem CID | 17245159 |
| Molecular Formula | C16H10Cl2IN3O2S |
| Molecular Weight | 506.15 g/mol |
| Exact Mass | 504.89 |
| IUPAC Name | 2-[[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(3-iodophenyl)acetamide |
| SMILES | O=C(CSc1nnc(-c2ccc(Cl)cc2Cl)o1)Nc1cccc(I)c1 |
| InChI | InChI=1S/C16H10Cl2IN3O2S/c17-9-4-5-12(13(18)6-9)15-21-22-16(24-15)25-8-14(23)20-11-3-1-2-10(19)7-11/h1-7H,8H2,(H,20,23) |
| InChIKey | FBGXVDRWHVQBPO-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.15 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|