C19H19BrN2O4S2 — CID 17246801
5-[(4-bromophenyl)sulfonyl-methylamino]-N-(2-methoxyethyl)-1-benzothiophene-2-carboxamide (PubChem CID 17246801) has the molecular formula C19H19BrN2O4S2 and a molecular weight of 483.41 g/mol. Its IUPAC name is 5-[(4-bromophenyl)sulfonyl-methylamino]-N-(2-methoxyethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 5-[(4-bromophenyl)sulfonyl-methylamino]-N-(2-methoxyethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17246801 |
| Molecular Formula | C19H19BrN2O4S2 |
| Molecular Weight | 483.41 g/mol |
| Exact Mass | 482.00 |
| IUPAC Name | 5-[(4-bromophenyl)sulfonyl-methylamino]-N-(2-methoxyethyl)-1-benzothiophene-2-carboxamide |
| SMILES | COCCNC(=O)c1cc2cc(N(C)S(=O)(=O)c3ccc(Br)cc3)ccc2s1 |
| InChI | InChI=1S/C19H19BrN2O4S2/c1-22(28(24,25)16-6-3-14(20)4-7-16)15-5-8-17-13(11-15)12-18(27-17)19(23)21-9-10-26-2/h3-8,11-12H,9-10H2,1-2H3,(H,21,23) |
| InChIKey | ZRSLBCMJUAZZEM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|