C30H28N2O6S — CID 17247430
methyl 2-[[2-[4-[benzyl-(4-methylphenyl)sulfonylamino]phenoxy]acetyl]amino]benzoate (PubChem CID 17247430) has the molecular formula C30H28N2O6S and a molecular weight of 544.63 g/mol. Its IUPAC name is methyl 2-[[2-[4-[benzyl-(4-methylphenyl)sulfonylamino]phenoxy]acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[4-[benzyl-(4-methylphenyl)sulfonylamino]phenoxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 17247430 |
| Molecular Formula | C30H28N2O6S |
| Molecular Weight | 544.63 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | methyl 2-[[2-[4-[benzyl-(4-methylphenyl)sulfonylamino]phenoxy]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)COc1ccc(N(Cc2ccccc2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H28N2O6S/c1-22-12-18-26(19-13-22)39(35,36)32(20-23-8-4-3-5-9-23)24-14-16-25(17-15-24)38-21-29(33)31-28-11-7-6-10-27(28)30(34)37-2/h3-19H,20-21H2,1-2H3,(H,31,33) |
| InChIKey | ZMUJIZFZTUEKFY-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.63 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |