C16H15N3O4S2 — CID 17247589
1-(benzenesulfonyl)-N-(pyridin-3-ylmethyl)pyrrole-3-sulfonamide (PubChem CID 17247589) has the molecular formula C16H15N3O4S2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-(pyridin-3-ylmethyl)pyrrole-3-sulfonamide.
| Compound Name | 1-(benzenesulfonyl)-N-(pyridin-3-ylmethyl)pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 17247589 |
| Molecular Formula | C16H15N3O4S2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 1-(benzenesulfonyl)-N-(pyridin-3-ylmethyl)pyrrole-3-sulfonamide |
| SMILES | O=S(=O)(NCc1cccnc1)c1ccn(S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C16H15N3O4S2/c20-24(21,18-12-14-5-4-9-17-11-14)16-8-10-19(13-16)25(22,23)15-6-2-1-3-7-15/h1-11,13,18H,12H2 |
| InChIKey | MRTZGUBUFUTQAC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |