C24H23ClN2O4S — CID 17248236
1-(3-chlorobenzoyl)-N-(4-ethoxyphenyl)-3,4-dihydro-2H-quinoline-6-sulfonamide (PubChem CID 17248236) has the molecular formula C24H23ClN2O4S and a molecular weight of 470.98 g/mol. Its IUPAC name is 1-(3-chlorobenzoyl)-N-(4-ethoxyphenyl)-3,4-dihydro-2H-quinoline-6-sulfonamide.
| Compound Name | 1-(3-chlorobenzoyl)-N-(4-ethoxyphenyl)-3,4-dihydro-2H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 17248236 |
| Molecular Formula | C24H23ClN2O4S |
| Molecular Weight | 470.98 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 1-(3-chlorobenzoyl)-N-(4-ethoxyphenyl)-3,4-dihydro-2H-quinoline-6-sulfonamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc3c(c2)CCCN3C(=O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C24H23ClN2O4S/c1-2-31-21-10-8-20(9-11-21)26-32(29,30)22-12-13-23-17(16-22)6-4-14-27(23)24(28)18-5-3-7-19(25)15-18/h3,5,7-13,15-16,26H,2,4,6,14H2,1H3 |
| InChIKey | WOOXLNXMMDQETD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.98 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |