About tetrapentylazanium
tetrapentylazanium (PubChem CID 17249) has the molecular formula C20H44N+
and a molecular weight of 298.58 g/mol. Its IUPAC name is tetrapentylazanium.
Molecular Properties
| Compound Name | tetrapentylazanium |
| PubChem CID | 17249 |
| Molecular Formula | C20H44N+ |
| Molecular Weight | 298.58 g/mol |
| Exact Mass | 298.35 |
| IUPAC Name | tetrapentylazanium |
| SMILES | CCCCC[N+](CCCCC)(CCCCC)CCCCC |
| InChI | InChI=1S/C20H44N/c1-5-9-13-17-21(18-14-10-6-2,19-15-11-7-3)20-16-12-8-4/h5-20H2,1-4H3/q+1 |
| InChIKey | GJSGYPDDPQRWPK-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.58 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetrapentylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrapentylazanium?
The IUPAC name of tetrapentylazanium (CID 17249) is tetrapentylazanium.
What is the SMILES notation for tetrapentylazanium?
The canonical SMILES for tetrapentylazanium is CCCCC[N+](CCCCC)(CCCCC)CCCCC.
What is the InChIKey of tetrapentylazanium?
The InChIKey is GJSGYPDDPQRWPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H44N/c1-5-9-13-17-21(18-14-10-6-2,19-15-11-7-3)20-16-12-8-4/h5-20H2,1-4H3/q+1.
What are the key properties of tetrapentylazanium?
tetrapentylazanium has a molecular weight of 298.58 g/mol, XLogP of 6.56, 16 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetrapentylazanium is sourced from PubChem (CID 17249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).