C19H24N2O3 — CID 17249513
2-(4-ethoxyphenyl)-1-[4-(furan-2-ylmethyl)piperazin-1-yl]ethanone (PubChem CID 17249513) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-1-[4-(furan-2-ylmethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(4-ethoxyphenyl)-1-[4-(furan-2-ylmethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 17249513 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 2-(4-ethoxyphenyl)-1-[4-(furan-2-ylmethyl)piperazin-1-yl]ethanone |
| SMILES | CCOc1ccc(CC(=O)N2CCN(Cc3ccco3)CC2)cc1 |
| InChI | InChI=1S/C19H24N2O3/c1-2-23-17-7-5-16(6-8-17)14-19(22)21-11-9-20(10-12-21)15-18-4-3-13-24-18/h3-8,13H,2,9-12,14-15H2,1H3 |
| InChIKey | QFSYKKLQOBIOMQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |