C18H23ClN2O4 — CID 17249879
2-(4-chloro-3-methylphenoxy)-1-[4-(oxolane-2-carbonyl)piperazin-1-yl]ethanone (PubChem CID 17249879) has the molecular formula C18H23ClN2O4 and a molecular weight of 366.85 g/mol. Its IUPAC name is 2-(4-chloro-3-methylphenoxy)-1-[4-(oxolane-2-carbonyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(4-chloro-3-methylphenoxy)-1-[4-(oxolane-2-carbonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 17249879 |
| Molecular Formula | C18H23ClN2O4 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 2-(4-chloro-3-methylphenoxy)-1-[4-(oxolane-2-carbonyl)piperazin-1-yl]ethanone |
| SMILES | Cc1cc(OCC(=O)N2CCN(C(=O)C3CCCO3)CC2)ccc1Cl |
| InChI | InChI=1S/C18H23ClN2O4/c1-13-11-14(4-5-15(13)19)25-12-17(22)20-6-8-21(9-7-20)18(23)16-3-2-10-24-16/h4-5,11,16H,2-3,6-10,12H2,1H3 |
| InChIKey | GXLXBDIFAUZQEE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |