About 8-tert-butyl-4H-pyrido[1,2-a]pyrimidine
8-tert-butyl-4H-pyrido[1,2-a]pyrimidine (PubChem CID 172500551) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 8-tert-butyl-4H-pyrido[1,2-a]pyrimidine.
Molecular Properties
| Compound Name | 8-tert-butyl-4H-pyrido[1,2-a]pyrimidine |
| PubChem CID | 172500551 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 8-tert-butyl-4H-pyrido[1,2-a]pyrimidine |
| SMILES | CC(C)(C)C1=CC2=NC=CCN2C=C1 |
| InChI | InChI=1S/C12H16N2/c1-12(2,3)10-5-8-14-7-4-6-13-11(14)9-10/h4-6,8-9H,7H2,1-3H3 |
| InChIKey | OJFLZHCRTNMEGD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-tert-butyl-4H-pyrido[1,2-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-tert-butyl-4H-pyrido[1,2-a]pyrimidine?
The IUPAC name of 8-tert-butyl-4H-pyrido[1,2-a]pyrimidine (CID 172500551) is 8-tert-butyl-4H-pyrido[1,2-a]pyrimidine.
What is the SMILES notation for 8-tert-butyl-4H-pyrido[1,2-a]pyrimidine?
The canonical SMILES for 8-tert-butyl-4H-pyrido[1,2-a]pyrimidine is CC(C)(C)C1=CC2=NC=CCN2C=C1.
What is the InChIKey of 8-tert-butyl-4H-pyrido[1,2-a]pyrimidine?
The InChIKey is OJFLZHCRTNMEGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2/c1-12(2,3)10-5-8-14-7-4-6-13-11(14)9-10/h4-6,8-9H,7H2,1-3H3.
What are the key properties of 8-tert-butyl-4H-pyrido[1,2-a]pyrimidine?
8-tert-butyl-4H-pyrido[1,2-a]pyrimidine has a molecular weight of 188.27 g/mol, XLogP of 2.71, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-tert-butyl-4H-pyrido[1,2-a]pyrimidine is sourced from PubChem (CID 172500551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).