C56H39N — CID 172503170
N-[2-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-N-(4-phenanthren-2-ylphenyl)-2-[2-(2-phenylphenyl)phenyl]aniline (PubChem CID 172503170) has the molecular formula C56H39N and a molecular weight of 730.97 g/mol. Its IUPAC name is N-[2-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-N-(4-phenanthren-2-ylphenyl)-2-[2-(2-phenylphenyl)phenyl]aniline.
| Compound Name | N-[2-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-N-(4-phenanthren-2-ylphenyl)-2-[2-(2-phenylphenyl)phenyl]aniline |
|---|---|
| PubChem CID | 172503170 |
| Molecular Formula | C56H39N |
| Molecular Weight | 730.97 g/mol |
| Exact Mass | 730.34 |
| IUPAC Name | N-[2-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-N-(4-phenanthren-2-ylphenyl)-2-[2-(2-phenylphenyl)phenyl]aniline |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccccc2N(c2ccc(-c3ccc4c(ccc5ccccc54)c3)cc2)c2ccccc2-c2ccccc2-c2ccccc2-c2ccccc2)c([2H])c1[2H] |
| InChI | InChI=1S/C56H39N/c1-3-17-41(18-4-1)48-23-9-10-25-51(48)52-26-11-12-27-53(52)54-28-14-16-30-56(54)57(55-29-15-13-24-50(55)42-19-5-2-6-20-42)46-36-33-40(34-37-46)44-35-38-49-45(39-44)32-31-43-21-7-8-22-47(43)49/h1-39H/i2D,5D,6D,19D,20D |
| InChIKey | VTGODUNEMHXZTB-VCZADUSTSA-N |
| XLogP | 15.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.97 |
| LogP ≤ 5 | 15.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|