C20H19N3O4S — CID 172503354
7-methyl-2,3-dioxo-N-(3-phenyl-1-bicyclo[1.1.1]pentanyl)-1,4-dihydroquinoxaline-6-sulfonamide (PubChem CID 172503354) has the molecular formula C20H19N3O4S and a molecular weight of 397.46 g/mol. Its IUPAC name is 7-methyl-2,3-dioxo-N-(3-phenyl-1-bicyclo[1.1.1]pentanyl)-1,4-dihydroquinoxaline-6-sulfonamide.
| Compound Name | 7-methyl-2,3-dioxo-N-(3-phenyl-1-bicyclo[1.1.1]pentanyl)-1,4-dihydroquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 172503354 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 7-methyl-2,3-dioxo-N-(3-phenyl-1-bicyclo[1.1.1]pentanyl)-1,4-dihydroquinoxaline-6-sulfonamide |
| SMILES | Cc1cc2[nH]c(=O)c(=O)[nH]c2cc1S(=O)(=O)NC12CC(c3ccccc3)(C1)C2 |
| InChI | InChI=1S/C20H19N3O4S/c1-12-7-14-15(22-18(25)17(24)21-14)8-16(12)28(26,27)23-20-9-19(10-20,11-20)13-5-3-2-4-6-13/h2-8,23H,9-11H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | TZEJMSXRHLRSNJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|