About 3-[[1-[(2R)-2,3-difluoropropyl]-3-methylpyrazol-4-yl]amino]pyrazine-2-carboxamide
3-[[1-[(2R)-2,3-difluoropropyl]-3-methylpyrazol-4-yl]amino]pyrazine-2-carboxamide (PubChem CID 172503414) has the molecular formula C12H14F2N6O
and a molecular weight of 296.28 g/mol. Its IUPAC name is 3-[[1-[(2R)-2,3-difluoropropyl]-3-methylpyrazol-4-yl]amino]pyrazine-2-carboxamide.
Molecular Properties
| Compound Name | 3-[[1-[(2R)-2,3-difluoropropyl]-3-methylpyrazol-4-yl]amino]pyrazine-2-carboxamide |
| PubChem CID | 172503414 |
| Molecular Formula | C12H14F2N6O |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 3-[[1-[(2R)-2,3-difluoropropyl]-3-methylpyrazol-4-yl]amino]pyrazine-2-carboxamide |
| SMILES | Cc1nn(C[C@@H](F)CF)cc1Nc1nccnc1C(N)=O |
| InChI | InChI=1S/C12H14F2N6O/c1-7-9(6-20(19-7)5-8(14)4-13)18-12-10(11(15)21)16-2-3-17-12/h2-3,6,8H,4-5H2,1H3,(H2,15,21)(H,17,18)/t8-/m0/s1 |
| InChIKey | SUPPZHZUGCSVOA-QMMMGPOBSA-N |
| XLogP | 1.13 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[1-[(2R)-2,3-difluoropropyl]-3-methylpyrazol-4-yl]amino]pyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[1-[(2R)-2,3-difluoropropyl]-3-methylpyrazol-4-yl]amino]pyrazine-2-carboxamide?
The IUPAC name of 3-[[1-[(2R)-2,3-difluoropropyl]-3-methylpyrazol-4-yl]amino]pyrazine-2-carboxamide (CID 172503414) is 3-[[1-[(2R)-2,3-difluoropropyl]-3-methylpyrazol-4-yl]amino]pyrazine-2-carboxamide.
What is the SMILES notation for 3-[[1-[(2R)-2,3-difluoropropyl]-3-methylpyrazol-4-yl]amino]pyrazine-2-carboxamide?
The canonical SMILES for 3-[[1-[(2R)-2,3-difluoropropyl]-3-methylpyrazol-4-yl]amino]pyrazine-2-carboxamide is Cc1nn(C[C@@H](F)CF)cc1Nc1nccnc1C(N)=O.
What is the InChIKey of 3-[[1-[(2R)-2,3-difluoropropyl]-3-methylpyrazol-4-yl]amino]pyrazine-2-carboxamide?
The InChIKey is SUPPZHZUGCSVOA-QMMMGPOBSA-N. The full InChI is InChI=1S/C12H14F2N6O/c1-7-9(6-20(19-7)5-8(14)4-13)18-12-10(11(15)21)16-2-3-17-12/h2-3,6,8H,4-5H2,1H3,(H2,15,21)(H,17,18)/t8-/m0/s1.
What are the key properties of 3-[[1-[(2R)-2,3-difluoropropyl]-3-methylpyrazol-4-yl]amino]pyrazine-2-carboxamide?
3-[[1-[(2R)-2,3-difluoropropyl]-3-methylpyrazol-4-yl]amino]pyrazine-2-carboxamide has a molecular weight of 296.28 g/mol, XLogP of 1.13, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[1-[(2R)-2,3-difluoropropyl]-3-methylpyrazol-4-yl]amino]pyrazine-2-carboxamide is sourced from PubChem (CID 172503414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).