C39H42N10O5 — CID 172504620
2-[4-[[4-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]piperazin-1-yl]methyl]cyclohexyl]-N-imidazo[1,2-b]pyridazin-3-yl-6-methoxyindazole-5-carboxamide (PubChem CID 172504620) has the molecular formula C39H42N10O5 and a molecular weight of 730.83 g/mol. Its IUPAC name is 2-[4-[[4-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]piperazin-1-yl]methyl]cyclohexyl]-N-imidazo[1,2-b]pyridazin-3-yl-6-methoxyindazole-5-carboxamide.
| Compound Name | 2-[4-[[4-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]piperazin-1-yl]methyl]cyclohexyl]-N-imidazo[1,2-b]pyridazin-3-yl-6-methoxyindazole-5-carboxamide |
|---|---|
| PubChem CID | 172504620 |
| Molecular Formula | C39H42N10O5 |
| Molecular Weight | 730.83 g/mol |
| Exact Mass | 730.33 |
| IUPAC Name | 2-[4-[[4-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]piperazin-1-yl]methyl]cyclohexyl]-N-imidazo[1,2-b]pyridazin-3-yl-6-methoxyindazole-5-carboxamide |
| SMILES | COc1cc2nn(C3CCC(CN4CCN(c5ccc6c(c5)C(=O)N(C5CCC(=O)NC5=O)C6)CC4)CC3)cc2cc1C(=O)Nc1cnc2cccnn12 |
| InChI | InChI=1S/C39H42N10O5/c1-54-33-19-31-26(17-30(33)37(51)42-35-20-40-34-3-2-12-41-49(34)35)23-48(44-31)27-7-4-24(5-8-27)21-45-13-15-46(16-14-45)28-9-6-25-22-47(39(53)29(25)18-28)32-10-11-36(50)43-38(32)52/h2-3,6,9,12,17-20,23-24,27,32H,4-5,7-8,10-11,13-16,21-22H2,1H3,(H,42,51)(H,43,50,52) |
| InChIKey | XOQOGNVJIAMKMX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 159.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.83 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|