C54H38N4OPd-2 — CID 172504658
CID 172504658 (PubChem CID 172504658) has the molecular formula C54H38N4OPd-2 and a molecular weight of 875.41 g/mol.
| Compound Name | CID 172504658 |
|---|---|
| PubChem CID | 172504658 |
| Molecular Formula | C54H38N4OPd-2 |
| Molecular Weight | 875.41 g/mol |
| Exact Mass | 874.27 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c2-[n+]2[c-]n(-c3[c-]c(Oc4[c-]c5c(cc4)c4cccc6c4n5-c4ncccc4C64CCCCC4)ccc3)c3ccccc32)c([2H])c1[2H].[Pd] |
| InChI | InChI=1S/C54H38N4O.Pd/c1-4-16-37(17-5-1)42-22-13-23-43(38-18-6-2-7-19-38)51(42)57-36-56(48-27-8-9-28-49(48)57)39-20-12-21-40(34-39)59-41-29-30-44-45-24-14-25-46-52(45)58(50(44)35-41)53-47(26-15-33-55-53)54(46)31-10-3-11-32-54;/h1-2,4-9,12-30,33H,3,10-11,31-32H2;/q-2;/i1D,2D,4D,5D,6D,7D,16D,17D,18D,19D; |
| InChIKey | GXPTXZOQQYAXTE-JTYBUIEKSA-N |
| XLogP | 12.49 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.41 |
| LogP ≤ 5 | 12.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|