C15H14I2O — CID 172505255
6,8-diiodotetracyclo[10.2.1.02,11.04,9]pentadeca-4(9),5,7-trien-3-one (PubChem CID 172505255) has the molecular formula C15H14I2O and a molecular weight of 464.08 g/mol. Its IUPAC name is 6,8-diiodotetracyclo[10.2.1.02,11.04,9]pentadeca-4(9),5,7-trien-3-one.
| Compound Name | 6,8-diiodotetracyclo[10.2.1.02,11.04,9]pentadeca-4(9),5,7-trien-3-one |
|---|---|
| PubChem CID | 172505255 |
| Molecular Formula | C15H14I2O |
| Molecular Weight | 464.08 g/mol |
| Exact Mass | 463.91 |
| IUPAC Name | 6,8-diiodotetracyclo[10.2.1.02,11.04,9]pentadeca-4(9),5,7-trien-3-one |
| SMILES | O=C1c2cc(I)cc(I)c2CC2C3CCC(C3)C12 |
| InChI | InChI=1S/C15H14I2O/c16-9-4-12-11(13(17)5-9)6-10-7-1-2-8(3-7)14(10)15(12)18/h4-5,7-8,10,14H,1-3,6H2 |
| InChIKey | JSKHIAWYXFJIAK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.08 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|