C24H46N2O2 — CID 172509028
1-[3-[[(E)-6,6-dimethylhept-2-enyl]amino]piperidin-1-yl]-2-(5,5-dimethylhexoxy)ethanone (PubChem CID 172509028) has the molecular formula C24H46N2O2 and a molecular weight of 394.64 g/mol. Its IUPAC name is 1-[3-[[(E)-6,6-dimethylhept-2-enyl]amino]piperidin-1-yl]-2-(5,5-dimethylhexoxy)ethanone.
| Compound Name | 1-[3-[[(E)-6,6-dimethylhept-2-enyl]amino]piperidin-1-yl]-2-(5,5-dimethylhexoxy)ethanone |
|---|---|
| PubChem CID | 172509028 |
| Molecular Formula | C24H46N2O2 |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 394.36 |
| IUPAC Name | 1-[3-[[(E)-6,6-dimethylhept-2-enyl]amino]piperidin-1-yl]-2-(5,5-dimethylhexoxy)ethanone |
| SMILES | CC(C)(C)CC/C=C/CNC1CCCN(C(=O)COCCCCC(C)(C)C)C1 |
| InChI | InChI=1S/C24H46N2O2/c1-23(2,3)14-8-7-10-16-25-21-13-12-17-26(19-21)22(27)20-28-18-11-9-15-24(4,5)6/h7,10,21,25H,8-9,11-20H2,1-6H3/b10-7+ |
| InChIKey | JDQIJXJWUBKYPC-JXMROGBWSA-N |
| XLogP | 5.18 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|