C43H45FN6O7 — CID 172510290
ethyl 6-[4-[4-[4-[4-[[1-[(4-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]phenoxy]-6-methoxyquinolin-7-yl]pyrazol-1-yl]piperidin-1-yl]-6-oxohexanoate (PubChem CID 172510290) has the molecular formula C43H45FN6O7 and a molecular weight of 776.87 g/mol. Its IUPAC name is ethyl 6-[4-[4-[4-[4-[[1-[(4-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]phenoxy]-6-methoxyquinolin-7-yl]pyrazol-1-yl]piperidin-1-yl]-6-oxohexanoate.
| Compound Name | ethyl 6-[4-[4-[4-[4-[[1-[(4-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]phenoxy]-6-methoxyquinolin-7-yl]pyrazol-1-yl]piperidin-1-yl]-6-oxohexanoate |
|---|---|
| PubChem CID | 172510290 |
| Molecular Formula | C43H45FN6O7 |
| Molecular Weight | 776.87 g/mol |
| Exact Mass | 776.33 |
| IUPAC Name | ethyl 6-[4-[4-[4-[4-[[1-[(4-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]phenoxy]-6-methoxyquinolin-7-yl]pyrazol-1-yl]piperidin-1-yl]-6-oxohexanoate |
| SMILES | CCOC(=O)CCCCC(=O)N1CCC(n2cc(-c3cc4nccc(Oc5ccc(NC(=O)C6(C(=O)Nc7ccc(F)cc7)CC6)cc5)c4cc3OC)cn2)CC1 |
| InChI | InChI=1S/C43H45FN6O7/c1-3-56-40(52)7-5-4-6-39(51)49-22-17-32(18-23-49)50-27-28(26-46-50)34-24-36-35(25-38(34)55-2)37(16-21-45-36)57-33-14-12-31(13-15-33)48-42(54)43(19-20-43)41(53)47-30-10-8-29(44)9-11-30/h8-16,21,24-27,32H,3-7,17-20,22-23H2,1-2H3,(H,47,53)(H,48,54) |
| InChIKey | MTNKOZITGFWUOX-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 153.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.87 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|