C69H64N5 — CID 172510768
CID 172510768 (PubChem CID 172510768) has the molecular formula C69H64N5 and a molecular weight of 963.31 g/mol.
| Compound Name | CID 172510768 |
|---|---|
| PubChem CID | 172510768 |
| Molecular Formula | C69H64N5 |
| Molecular Weight | 963.31 g/mol |
| Exact Mass | 962.52 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C=CN(c2c(C(C)C)cccc2C(C)C)[C]1c1ccc(N(c2ccc3c(c2)c2ccccc2n3-c2ccccc2)c2ccc3c(c2)c2ccccc2n3-c2ccccc2)cc1 |
| InChI | InChI=1S/C69H64N5/c1-45(2)55-27-19-28-56(46(3)4)67(55)70-41-42-71(68-57(47(5)6)29-20-30-58(68)48(7)8)69(70)49-33-35-52(36-34-49)72(53-37-39-65-61(43-53)59-25-15-17-31-63(59)73(65)50-21-11-9-12-22-50)54-38-40-66-62(44-54)60-26-16-18-32-64(60)74(66)51-23-13-10-14-24-51/h9-48H,1-8H3 |
| InChIKey | GTQDHCVABJZBIG-UHFFFAOYSA-N |
| XLogP | 19.18 |
| TPSA | 19.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.31 |
| LogP ≤ 5 | 19.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |