C21H30O4 — CID 172510918
3-hydroxy-2-(5-hydroxy-5-methyl-2-prop-1-en-2-ylcyclohexyl)-5-pentylcyclohexa-2,5-diene-1,4-dione (PubChem CID 172510918) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is 3-hydroxy-2-(5-hydroxy-5-methyl-2-prop-1-en-2-ylcyclohexyl)-5-pentylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 3-hydroxy-2-(5-hydroxy-5-methyl-2-prop-1-en-2-ylcyclohexyl)-5-pentylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 172510918 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 3-hydroxy-2-(5-hydroxy-5-methyl-2-prop-1-en-2-ylcyclohexyl)-5-pentylcyclohexa-2,5-diene-1,4-dione |
| SMILES | C=C(C)C1CCC(C)(O)CC1C1=C(O)C(=O)C(CCCCC)=CC1=O |
| InChI | InChI=1S/C21H30O4/c1-5-6-7-8-14-11-17(22)18(20(24)19(14)23)16-12-21(4,25)10-9-15(16)13(2)3/h11,15-16,24-25H,2,5-10,12H2,1,3-4H3 |
| InChIKey | OPMNMSDTOMTFQN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|