C20H38FN3 — CID 172511305
1-tert-butyl-3-fluoro-4-[(4-piperidin-4-ylpiperidin-1-yl)methyl]piperidine (PubChem CID 172511305) has the molecular formula C20H38FN3 and a molecular weight of 339.54 g/mol. Its IUPAC name is 1-tert-butyl-3-fluoro-4-[(4-piperidin-4-ylpiperidin-1-yl)methyl]piperidine.
| Compound Name | 1-tert-butyl-3-fluoro-4-[(4-piperidin-4-ylpiperidin-1-yl)methyl]piperidine |
|---|---|
| PubChem CID | 172511305 |
| Molecular Formula | C20H38FN3 |
| Molecular Weight | 339.54 g/mol |
| Exact Mass | 339.30 |
| IUPAC Name | 1-tert-butyl-3-fluoro-4-[(4-piperidin-4-ylpiperidin-1-yl)methyl]piperidine |
| SMILES | CC(C)(C)N1CCC(CN2CCC(C3CCNCC3)CC2)C(F)C1 |
| InChI | InChI=1S/C20H38FN3/c1-20(2,3)24-13-8-18(19(21)15-24)14-23-11-6-17(7-12-23)16-4-9-22-10-5-16/h16-19,22H,4-15H2,1-3H3 |
| InChIKey | SRNJKSOCWJGCEX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.54 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |