C24H34FIN3O2S- — CID 172512450
propyliodanuidyl N-[[3-[2-(5-fluorothiophen-2-yl)ethyl]-1-[2-(6-methyl-3-pyridinyl)propan-2-yl]pyrrolidin-3-yl]methyl]carbamate (PubChem CID 172512450) has the molecular formula C24H34FIN3O2S- and a molecular weight of 574.52 g/mol. Its IUPAC name is propyliodanuidyl N-[[3-[2-(5-fluorothiophen-2-yl)ethyl]-1-[2-(6-methyl-3-pyridinyl)propan-2-yl]pyrrolidin-3-yl]methyl]carbamate.
| Compound Name | propyliodanuidyl N-[[3-[2-(5-fluorothiophen-2-yl)ethyl]-1-[2-(6-methyl-3-pyridinyl)propan-2-yl]pyrrolidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 172512450 |
| Molecular Formula | C24H34FIN3O2S- |
| Molecular Weight | 574.52 g/mol |
| Exact Mass | 574.14 |
| IUPAC Name | propyliodanuidyl N-[[3-[2-(5-fluorothiophen-2-yl)ethyl]-1-[2-(6-methyl-3-pyridinyl)propan-2-yl]pyrrolidin-3-yl]methyl]carbamate |
| SMILES | CCC[I-]OC(=O)NCC1(CCc2ccc(F)s2)CCN(C(C)(C)c2ccc(C)nc2)C1 |
| InChI | InChI=1S/C24H34FIN3O2S/c1-5-13-26-31-22(30)28-16-24(11-10-20-8-9-21(25)32-20)12-14-29(17-24)23(3,4)19-7-6-18(2)27-15-19/h6-9,15H,5,10-14,16-17H2,1-4H3,(H,28,30)/q-1 |
| InChIKey | ODEKLDHKVYFLNW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.52 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|