C30H30ClN5O2 — CID 172513091
4-[8-chloro-13-methyl-3-[[(8S)-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methoxy]-10-oxa-2,4,13-triazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-7-yl]naphthalen-2-amine (PubChem CID 172513091) has the molecular formula C30H30ClN5O2 and a molecular weight of 528.06 g/mol. Its IUPAC name is 4-[8-chloro-13-methyl-3-[[(8S)-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methoxy]-10-oxa-2,4,13-triazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-7-yl]naphthalen-2-amine.
| Compound Name | 4-[8-chloro-13-methyl-3-[[(8S)-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methoxy]-10-oxa-2,4,13-triazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-7-yl]naphthalen-2-amine |
|---|---|
| PubChem CID | 172513091 |
| Molecular Formula | C30H30ClN5O2 |
| Molecular Weight | 528.06 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | 4-[8-chloro-13-methyl-3-[[(8S)-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methoxy]-10-oxa-2,4,13-triazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-7-yl]naphthalen-2-amine |
| SMILES | C=C1CN2CCC[C@@]2(COc2nc3c4c(c(Cl)c(-c5cc(N)cc6ccccc56)cc4n2)OCCN3C)C1 |
| InChI | InChI=1S/C30H30ClN5O2/c1-18-15-30(8-5-9-36(30)16-18)17-38-29-33-24-14-23(22-13-20(32)12-19-6-3-4-7-21(19)22)26(31)27-25(24)28(34-29)35(2)10-11-37-27/h3-4,6-7,12-14H,1,5,8-11,15-17,32H2,2H3/t30-/m0/s1 |
| InChIKey | LBKVMKXEMIXJSO-PMERELPUSA-N |
| XLogP | 5.69 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.06 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|