C8H14FNO — CID 172513105
[(1S,6R)-6-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methanol (PubChem CID 172513105) has the molecular formula C8H14FNO and a molecular weight of 159.20 g/mol. Its IUPAC name is [(1S,6R)-6-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methanol.
| Compound Name | [(1S,6R)-6-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methanol |
|---|---|
| PubChem CID | 172513105 |
| Molecular Formula | C8H14FNO |
| Molecular Weight | 159.20 g/mol |
| Exact Mass | 159.11 |
| IUPAC Name | [(1S,6R)-6-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methanol |
| SMILES | OC[C@H]1CCN2C[C@H](F)CC12 |
| InChI | InChI=1S/C8H14FNO/c9-7-3-8-6(5-11)1-2-10(8)4-7/h6-8,11H,1-5H2/t6-,7-,8?/m1/s1 |
| InChIKey | DIKNZXPRRNUCNT-GCJDJSOWSA-N |
| XLogP | 0.41 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.20 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |