About (4R)-2,4,5,5-tetramethylhex-2-ene
(4R)-2,4,5,5-tetramethylhex-2-ene (PubChem CID 172513214) has the molecular formula C10H20
and a molecular weight of 140.27 g/mol. Its IUPAC name is (4R)-2,4,5,5-tetramethylhex-2-ene.
Molecular Properties
| Compound Name | (4R)-2,4,5,5-tetramethylhex-2-ene |
|---|
| PubChem CID | 172513214 |
|---|
| Molecular Formula | C10H20 |
|---|
| Molecular Weight | 140.27 g/mol |
|---|
| Exact Mass | 140.16 |
|---|
| IUPAC Name | (4R)-2,4,5,5-tetramethylhex-2-ene |
|---|
| SMILES | CC(C)=C[C@@H](C)C(C)(C)C |
|---|
| InChI | InChI=1S/C10H20/c1-8(2)7-9(3)10(4,5)6/h7,9H,1-6H3/t9-/m1/s1 |
|---|
| InChIKey | XCUQPPZXXSKCCO-SECBINFHSA-N |
|---|
| XLogP | 3.63 |
|---|
| TPSA | 0.00 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | |
|---|
| Rotatable Bonds | 1 |
|---|
| Heavy Atoms | 10 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 140.27 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R)-2,4,5,5-tetramethylhex-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2,4,5,5-tetramethylhex-2-ene?
The IUPAC name of (4R)-2,4,5,5-tetramethylhex-2-ene (CID 172513214) is (4R)-2,4,5,5-tetramethylhex-2-ene.
What is the SMILES notation for (4R)-2,4,5,5-tetramethylhex-2-ene?
The canonical SMILES for (4R)-2,4,5,5-tetramethylhex-2-ene is CC(C)=C[C@@H](C)C(C)(C)C.
What is the InChIKey of (4R)-2,4,5,5-tetramethylhex-2-ene?
The InChIKey is XCUQPPZXXSKCCO-SECBINFHSA-N. The full InChI is InChI=1S/C10H20/c1-8(2)7-9(3)10(4,5)6/h7,9H,1-6H3/t9-/m1/s1.
What are the key properties of (4R)-2,4,5,5-tetramethylhex-2-ene?
(4R)-2,4,5,5-tetramethylhex-2-ene has a molecular weight of 140.27 g/mol, XLogP of 3.63, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2,4,5,5-tetramethylhex-2-ene is sourced from PubChem (CID 172513214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).