C29H37N4O3P — CID 172514745
[[(2R,3R,5R)-5-[3-[(E)-2-cyanoethenyl]carbazol-9-yl]-2-(deuteriomethyl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl] N-ethylmethanimidate (PubChem CID 172514745) has the molecular formula C29H37N4O3P and a molecular weight of 521.62 g/mol. Its IUPAC name is [[(2R,3R,5R)-5-[3-[(E)-2-cyanoethenyl]carbazol-9-yl]-2-(deuteriomethyl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl] N-ethylmethanimidate.
| Compound Name | [[(2R,3R,5R)-5-[3-[(E)-2-cyanoethenyl]carbazol-9-yl]-2-(deuteriomethyl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl] N-ethylmethanimidate |
|---|---|
| PubChem CID | 172514745 |
| Molecular Formula | C29H37N4O3P |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.27 |
| IUPAC Name | [[(2R,3R,5R)-5-[3-[(E)-2-cyanoethenyl]carbazol-9-yl]-2-(deuteriomethyl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl] N-ethylmethanimidate |
| SMILES | [2H]C[C@H]1O[C@@H](n2c3ccccc3c3cc(/C=C/C#N)ccc32)C[C@H]1OP(O/C=N/CC)N(C(C)C)C(C)C |
| InChI | InChI=1S/C29H37N4O3P/c1-7-31-19-34-37(33(20(2)3)21(4)5)36-28-18-29(35-22(28)6)32-26-13-9-8-12-24(26)25-17-23(11-10-16-30)14-15-27(25)32/h8-15,17,19-22,28-29H,7,18H2,1-6H3/b11-10+,31-19+/t22-,28-,29-,37?/m1/s1/i6D |
| InChIKey | VSZMWZPUIJTOEJ-VMDQUTHRSA-N |
| XLogP | 7.43 |
| TPSA | 72.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|