About 2-methylpropan-1-one;pyrrol-1-ide-2,5-dione;tungsten(2+)
2-methylpropan-1-one;pyrrol-1-ide-2,5-dione;tungsten(2+) (PubChem CID 172514769) has the molecular formula C8H9NO3W
and a molecular weight of 351.00 g/mol. Its IUPAC name is 2-methylpropan-1-one;pyrrol-1-ide-2,5-dione;tungsten(2+).
Molecular Properties
| Compound Name | 2-methylpropan-1-one;pyrrol-1-ide-2,5-dione;tungsten(2+) |
| PubChem CID | 172514769 |
| Molecular Formula | C8H9NO3W |
| Molecular Weight | 351.00 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 2-methylpropan-1-one;pyrrol-1-ide-2,5-dione;tungsten(2+) |
| SMILES | CC(C)[C-]=O.O=C1C=CC(=O)[N-]1.[W+2] |
| InChI | InChI=1S/C4H3NO2.C4H7O.W/c6-3-1-2-4(7)5-3;1-4(2)3-5;/h1-2H,(H,5,6,7);4H,1-2H3;/q;-1;+2/p-1 |
| InChIKey | UYVQLRMCIIAARW-UHFFFAOYSA-M |
| XLogP | 0.73 |
| TPSA | 65.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.00 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropan-1-one;pyrrol-1-ide-2,5-dione;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropan-1-one;pyrrol-1-ide-2,5-dione;tungsten(2+)?
The IUPAC name of 2-methylpropan-1-one;pyrrol-1-ide-2,5-dione;tungsten(2+) (CID 172514769) is 2-methylpropan-1-one;pyrrol-1-ide-2,5-dione;tungsten(2+).
What is the SMILES notation for 2-methylpropan-1-one;pyrrol-1-ide-2,5-dione;tungsten(2+)?
The canonical SMILES for 2-methylpropan-1-one;pyrrol-1-ide-2,5-dione;tungsten(2+) is CC(C)[C-]=O.O=C1C=CC(=O)[N-]1.[W+2].
What is the InChIKey of 2-methylpropan-1-one;pyrrol-1-ide-2,5-dione;tungsten(2+)?
The InChIKey is UYVQLRMCIIAARW-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H3NO2.C4H7O.W/c6-3-1-2-4(7)5-3;1-4(2)3-5;/h1-2H,(H,5,6,7);4H,1-2H3;/q;-1;+2/p-1.
What are the key properties of 2-methylpropan-1-one;pyrrol-1-ide-2,5-dione;tungsten(2+)?
2-methylpropan-1-one;pyrrol-1-ide-2,5-dione;tungsten(2+) has a molecular weight of 351.00 g/mol, XLogP of 0.73, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropan-1-one;pyrrol-1-ide-2,5-dione;tungsten(2+) is sourced from PubChem (CID 172514769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).