C23H19N3O5 — CID 172514891
(10S)-19-amino-10-ethyl-10-hydroxy-18-methyl-8,21-dioxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16(24),17,19,22-octaene-5,9-dione (PubChem CID 172514891) has the molecular formula C23H19N3O5 and a molecular weight of 417.42 g/mol. Its IUPAC name is (10S)-19-amino-10-ethyl-10-hydroxy-18-methyl-8,21-dioxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16(24),17,19,22-octaene-5,9-dione.
| Compound Name | (10S)-19-amino-10-ethyl-10-hydroxy-18-methyl-8,21-dioxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16(24),17,19,22-octaene-5,9-dione |
|---|---|
| PubChem CID | 172514891 |
| Molecular Formula | C23H19N3O5 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | (10S)-19-amino-10-ethyl-10-hydroxy-18-methyl-8,21-dioxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16(24),17,19,22-octaene-5,9-dione |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc(C)c(N)c3c1c2C=CO3 |
| InChI | InChI=1S/C23H19N3O5/c1-3-23(29)14-7-16-19-12(8-26(16)21(27)13(14)9-31-22(23)28)11-4-5-30-20-17(11)15(25-19)6-10(2)18(20)24/h4-7,29H,3,8-9,24H2,1-2H3/t23-/m0/s1 |
| InChIKey | NZFUZQJVYRAGMF-QHCPKHFHSA-N |
| XLogP | 2.33 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|