C48H32N2 — CID 172515275
12-(2-phenylphenyl)-5-[2,4,6-trideuterio-3,5-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]indolo[3,2-c]carbazole (PubChem CID 172515275) has the molecular formula C48H32N2 and a molecular weight of 649.88 g/mol. Its IUPAC name is 12-(2-phenylphenyl)-5-[2,4,6-trideuterio-3,5-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]indolo[3,2-c]carbazole.
| Compound Name | 12-(2-phenylphenyl)-5-[2,4,6-trideuterio-3,5-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]indolo[3,2-c]carbazole |
|---|---|
| PubChem CID | 172515275 |
| Molecular Formula | C48H32N2 |
| Molecular Weight | 649.88 g/mol |
| Exact Mass | 649.34 |
| IUPAC Name | 12-(2-phenylphenyl)-5-[2,4,6-trideuterio-3,5-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]indolo[3,2-c]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c([2H])c(-n3c4ccccc4c4c3ccc3c5ccccc5n(-c5ccccc5-c5ccccc5)c34)c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C48H32N2/c1-4-16-33(17-5-1)36-30-37(34-18-6-2-7-19-34)32-38(31-36)49-45-27-15-12-24-42(45)47-46(49)29-28-41-40-23-11-14-26-44(40)50(48(41)47)43-25-13-10-22-39(43)35-20-8-3-9-21-35/h1-32H/i1D,2D,4D,5D,6D,7D,16D,17D,18D,19D,30D,31D,32D |
| InChIKey | GPNLFYLXMOOYEO-ZMTSXASMSA-N |
| XLogP | 12.88 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.88 |
| LogP ≤ 5 | 12.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |