C17H19F5N6O — CID 172515785
(1R)-1-[3-[(3S)-1-(3,3,4,4,4-pentafluorobutyl)pyrrolidin-3-yl]-3,5,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol (PubChem CID 172515785) has the molecular formula C17H19F5N6O and a molecular weight of 418.37 g/mol. Its IUPAC name is (1R)-1-[3-[(3S)-1-(3,3,4,4,4-pentafluorobutyl)pyrrolidin-3-yl]-3,5,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol.
| Compound Name | (1R)-1-[3-[(3S)-1-(3,3,4,4,4-pentafluorobutyl)pyrrolidin-3-yl]-3,5,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol |
|---|---|
| PubChem CID | 172515785 |
| Molecular Formula | C17H19F5N6O |
| Molecular Weight | 418.37 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | (1R)-1-[3-[(3S)-1-(3,3,4,4,4-pentafluorobutyl)pyrrolidin-3-yl]-3,5,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol |
| SMILES | C[C@@H](O)c1nc2cnc3[nH]ncc3c2n1[C@H]1CCN(CCC(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C17H19F5N6O/c1-9(29)15-25-12-7-23-14-11(6-24-26-14)13(12)28(15)10-2-4-27(8-10)5-3-16(18,19)17(20,21)22/h6-7,9-10,29H,2-5,8H2,1H3,(H,23,24,26)/t9-,10+/m1/s1 |
| InChIKey | GFEFIYKNRFYNTA-ZJUUUORDSA-N |
| XLogP | 3.20 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|